C15H15Cl2FN3+ — CID 9363085
1-(3,5-dichloropyridin-1-ium-2-yl)-4-(2-fluorophenyl)piperazine (PubChem CID 9363085) has the molecular formula C15H15Cl2FN3+ and a molecular weight of 327.21 g/mol. Its IUPAC name is 1-(3,5-dichloropyridin-1-ium-2-yl)-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-(3,5-dichloropyridin-1-ium-2-yl)-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 9363085 |
| Molecular Formula | C15H15Cl2FN3+ |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-(3,5-dichloropyridin-1-ium-2-yl)-4-(2-fluorophenyl)piperazine |
| SMILES | Fc1ccccc1N1CCN(c2[nH+]cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H14Cl2FN3/c16-11-9-12(17)15(19-10-11)21-7-5-20(6-8-21)14-4-2-1-3-13(14)18/h1-4,9-10H,5-8H2/p+1 |
| InChIKey | WLUGHTWSDPGLMK-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 20.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |