C16H18N2O7 — CID 9363590
[(1S)-2-oxocyclohexyl] 2-[(4-methoxy-3-nitrobenzoyl)amino]acetate (PubChem CID 9363590) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 2-[(4-methoxy-3-nitrobenzoyl)amino]acetate.
| Compound Name | [(1S)-2-oxocyclohexyl] 2-[(4-methoxy-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9363590 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 2-[(4-methoxy-3-nitrobenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)O[C@H]2CCCCC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N2O7/c1-24-13-7-6-10(8-11(13)18(22)23)16(21)17-9-15(20)25-14-5-3-2-4-12(14)19/h6-8,14H,2-5,9H2,1H3,(H,17,21)/t14-/m0/s1 |
| InChIKey | RNMQKFVAYSKNPN-AWEZNQCLSA-N |
| XLogP | 1.39 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|