About 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one
3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one (PubChem CID 936422) has the molecular formula C19H18N2O
and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one |
| PubChem CID | 936422 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc(C)c(/N=C/c2cc3cc(C)ccc3[nH]c2=O)c1 |
| InChI | InChI=1S/C19H18N2O/c1-12-5-7-17-15(8-12)10-16(19(22)21-17)11-20-18-9-13(2)4-6-14(18)3/h4-11H,1-3H3,(H,21,22)/b20-11+ |
| InChIKey | LJELRQYBINMICV-RGVLZGJSSA-N |
| XLogP | 4.20 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one?
The IUPAC name of 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one (CID 936422) is 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one.
What is the SMILES notation for 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one?
The canonical SMILES for 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one is Cc1ccc(C)c(/N=C/c2cc3cc(C)ccc3[nH]c2=O)c1.
What is the InChIKey of 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one?
The InChIKey is LJELRQYBINMICV-RGVLZGJSSA-N. The full InChI is InChI=1S/C19H18N2O/c1-12-5-7-17-15(8-12)10-16(19(22)21-17)11-20-18-9-13(2)4-6-14(18)3/h4-11H,1-3H3,(H,21,22)/b20-11+.
What are the key properties of 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one?
3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one has a molecular weight of 290.37 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethylphenyl)iminomethyl]-6-methyl-1H-quinolin-2-one is sourced from PubChem (CID 936422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).