C17H16BrNO4 — CID 9364238
(2-methoxyphenyl)methyl 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 9364238) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | (2-methoxyphenyl)methyl 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9364238 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2-methoxyphenyl)methyl 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | COc1ccccc1COC(=O)CNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrNO4/c1-22-15-5-3-2-4-13(15)11-23-16(20)10-19-17(21)12-6-8-14(18)9-7-12/h2-9H,10-11H2,1H3,(H,19,21) |
| InChIKey | IDHNVFBKLZXTJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |