C17H21BrN2O4 — CID 9364264
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 9364264) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9364264 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | C[C@@H]1CCCN(C(=O)COC(=O)CNC(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H21BrN2O4/c1-12-3-2-8-20(10-12)15(21)11-24-16(22)9-19-17(23)13-4-6-14(18)7-5-13/h4-7,12H,2-3,8-11H2,1H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | KOJJESWELPATCD-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |