C15H18ClN3O5 — CID 9364849
(3S)-N-(2-chloro-4-nitrophenyl)-1-[(2S)-1-methoxypropan-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 9364849) has the molecular formula C15H18ClN3O5 and a molecular weight of 355.78 g/mol. Its IUPAC name is (3S)-N-(2-chloro-4-nitrophenyl)-1-[(2S)-1-methoxypropan-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2-chloro-4-nitrophenyl)-1-[(2S)-1-methoxypropan-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9364849 |
| Molecular Formula | C15H18ClN3O5 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (3S)-N-(2-chloro-4-nitrophenyl)-1-[(2S)-1-methoxypropan-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COC[C@H](C)N1C[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)CC1=O |
| InChI | InChI=1S/C15H18ClN3O5/c1-9(8-24-2)18-7-10(5-14(18)20)15(21)17-13-4-3-11(19(22)23)6-12(13)16/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,17,21)/t9-,10-/m0/s1 |
| InChIKey | FDHGVUBFJZFSJM-UWVGGRQHSA-N |
| XLogP | 2.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|