C20H30N3O3+ — CID 9364973
(4R)-4-(4-benzylpiperazin-4-ium-1-carbonyl)-1-[(2R)-1-methoxypropan-2-yl]pyrrolidin-2-one (PubChem CID 9364973) has the molecular formula C20H30N3O3+ and a molecular weight of 360.48 g/mol. Its IUPAC name is (4R)-4-(4-benzylpiperazin-4-ium-1-carbonyl)-1-[(2R)-1-methoxypropan-2-yl]pyrrolidin-2-one.
| Compound Name | (4R)-4-(4-benzylpiperazin-4-ium-1-carbonyl)-1-[(2R)-1-methoxypropan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9364973 |
| Molecular Formula | C20H30N3O3+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4R)-4-(4-benzylpiperazin-4-ium-1-carbonyl)-1-[(2R)-1-methoxypropan-2-yl]pyrrolidin-2-one |
| SMILES | COC[C@@H](C)N1C[C@H](C(=O)N2CC[NH+](Cc3ccccc3)CC2)CC1=O |
| InChI | InChI=1S/C20H29N3O3/c1-16(15-26-2)23-14-18(12-19(23)24)20(25)22-10-8-21(9-11-22)13-17-6-4-3-5-7-17/h3-7,16,18H,8-15H2,1-2H3/p+1/t16-,18-/m1/s1 |
| InChIKey | KRJPGDFTWCUWLQ-SJLPKXTDSA-O |
| XLogP | -0.20 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |