C17H24N4O4S — CID 9365504
3-(3-methoxypropyl)-1-methyl-1-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]amino]thiourea (PubChem CID 9365504) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1-methyl-1-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]amino]thiourea.
| Compound Name | 3-(3-methoxypropyl)-1-methyl-1-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9365504 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(3-methoxypropyl)-1-methyl-1-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]amino]thiourea |
| SMILES | COCCCNC(=S)N(C)NC(=O)CN1C(=O)CCOc2ccccc21 |
| InChI | InChI=1S/C17H24N4O4S/c1-20(17(26)18-9-5-10-24-2)19-15(22)12-21-13-6-3-4-7-14(13)25-11-8-16(21)23/h3-4,6-7H,5,8-12H2,1-2H3,(H,18,26)(H,19,22) |
| InChIKey | YXSWCHXMJQTAGW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|