C19H17NO2 — CID 9365900
(E)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 9365900) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9365900 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (E)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H17NO2/c1-14(18-13-16-9-5-6-10-17(16)22-18)20-19(21)12-11-15-7-3-2-4-8-15/h2-14H,1H3,(H,20,21)/b12-11+/t14-/m1/s1 |
| InChIKey | KFQCYMRJZKDFSG-GCZGRYASSA-N |
| XLogP | 4.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|