C16H12ClN3O4 — CID 9366641
3-(2-chlorophenyl)-N'-(furan-2-carbonyl)-5-methyl-1,2-oxazole-4-carbohydrazide (PubChem CID 9366641) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N'-(furan-2-carbonyl)-5-methyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2-chlorophenyl)-N'-(furan-2-carbonyl)-5-methyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9366641 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-(2-chlorophenyl)-N'-(furan-2-carbonyl)-5-methyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H12ClN3O4/c1-9-13(14(20-24-9)10-5-2-3-6-11(10)17)16(22)19-18-15(21)12-7-4-8-23-12/h2-8H,1H3,(H,18,21)(H,19,22) |
| InChIKey | FDMUYFUHRPZDEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|