About N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide
N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide (PubChem CID 9367168) has the molecular formula C14H12F2N2O3S
and a molecular weight of 326.32 g/mol. Its IUPAC name is N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide |
| PubChem CID | 9367168 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide |
| SMILES | O=C(CCSc1ccc(F)c(F)c1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H12F2N2O3S/c15-10-4-3-9(8-11(10)16)22-7-5-13(19)17-18-14(20)12-2-1-6-21-12/h1-4,6,8H,5,7H2,(H,17,19)(H,18,20) |
| InChIKey | PJVUJFCRSCHPCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide?
The IUPAC name of N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide (CID 9367168) is N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide.
What is the SMILES notation for N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide?
The canonical SMILES for N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide is O=C(CCSc1ccc(F)c(F)c1)NNC(=O)c1ccco1.
What is the InChIKey of N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide?
The InChIKey is PJVUJFCRSCHPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O3S/c15-10-4-3-9(8-11(10)16)22-7-5-13(19)17-18-14(20)12-2-1-6-21-12/h1-4,6,8H,5,7H2,(H,17,19)(H,18,20).
What are the key properties of N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide?
N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide has a molecular weight of 326.32 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(3,4-difluorophenyl)sulfanylpropanoyl]furan-2-carbohydrazide is sourced from PubChem (CID 9367168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).