About 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol
4-(5-amino-1,3,4-thiadiazol-2-yl)phenol (PubChem CID 936815) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol |
| PubChem CID | 936815 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol |
| SMILES | Nc1nnc(-c2ccc(O)cc2)s1 |
| InChI | InChI=1S/C8H7N3OS/c9-8-11-10-7(13-8)5-1-3-6(12)4-2-5/h1-4,12H,(H2,9,11) |
| InChIKey | ZLHDTOUWXDZDGO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol?
The IUPAC name of 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol (CID 936815) is 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol.
What is the SMILES notation for 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol?
The canonical SMILES for 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol is Nc1nnc(-c2ccc(O)cc2)s1.
What is the InChIKey of 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol?
The InChIKey is ZLHDTOUWXDZDGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c9-8-11-10-7(13-8)5-1-3-6(12)4-2-5/h1-4,12H,(H2,9,11).
What are the key properties of 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol?
4-(5-amino-1,3,4-thiadiazol-2-yl)phenol has a molecular weight of 193.23 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol is sourced from PubChem (CID 936815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).