C22H20F2N2O2 — CID 9369657
2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(2-phenoxyphenyl)acetamide (PubChem CID 9369657) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9369657 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(2-phenoxyphenyl)acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1Oc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H20F2N2O2/c1-15(18-12-11-16(23)13-19(18)24)25-14-22(27)26-20-9-5-6-10-21(20)28-17-7-3-2-4-8-17/h2-13,15,25H,14H2,1H3,(H,26,27)/t15-/m1/s1 |
| InChIKey | GLYBGBAPZIKEBJ-OAHLLOKOSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |