C17H17F2N3O4 — CID 9370182
2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 9370182) has the molecular formula C17H17F2N3O4 and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9370182 |
| Molecular Formula | C17H17F2N3O4 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN[C@H](C)c2ccc(F)cc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17F2N3O4/c1-10(13-5-3-11(18)7-14(13)19)20-9-17(23)21-15-6-4-12(26-2)8-16(15)22(24)25/h3-8,10,20H,9H2,1-2H3,(H,21,23)/t10-/m1/s1 |
| InChIKey | ZYHFAJXFDUYQFQ-SNVBAGLBSA-N |
| XLogP | 3.17 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|