C19H25N3O — CID 937085
1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-piperidin-1-ylethanone (PubChem CID 937085) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-piperidin-1-ylethanone.
| Compound Name | 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 937085 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-piperidin-1-ylethanone |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C(=O)CN1CCCCC1)CC3 |
| InChI | InChI=1S/C19H25N3O/c1-14-5-6-17-15(11-14)16-12-22(10-7-18(16)20-17)19(23)13-21-8-3-2-4-9-21/h5-6,11,20H,2-4,7-10,12-13H2,1H3 |
| InChIKey | AZFMNAPGASLYTP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|