1,5-dimethylindole-2-carboxylic acid

C11H11NO2 — CID 937169

IUPAC1,5-dimethylindole-2-carboxylic acid
SMILESCc1ccc2c(c1)cc(C(=O)O)n2C
InChIInChI=1S/C11H11NO2/c1-7-3-4-9-8(5-7)6-10(11(13)14)12(9)2/h3-6H,1-2H3,(H,13,14)
InChIKeyWBVJWABYADZXNO-UHFFFAOYSA-N
MW189.21 g/mol
LogP2.18
Rot. Bonds1

About 1,5-dimethylindole-2-carboxylic acid

1,5-dimethylindole-2-carboxylic acid (PubChem CID 937169) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1,5-dimethylindole-2-carboxylic acid.

Molecular Properties

Compound Name1,5-dimethylindole-2-carboxylic acid
PubChem CID937169
Molecular FormulaC11H11NO2
Molecular Weight189.21 g/mol
Exact Mass189.08
IUPAC Name1,5-dimethylindole-2-carboxylic acid
SMILESCc1ccc2c(c1)cc(C(=O)O)n2C
InChIInChI=1S/C11H11NO2/c1-7-3-4-9-8(5-7)6-10(11(13)14)12(9)2/h3-6H,1-2H3,(H,13,14)
InChIKeyWBVJWABYADZXNO-UHFFFAOYSA-N
XLogP2.18
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.21
LogP ≤ 52.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,5-dimethylindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dimethylindole-2-carboxylic acid?
The IUPAC name of 1,5-dimethylindole-2-carboxylic acid (CID 937169) is 1,5-dimethylindole-2-carboxylic acid.
What is the SMILES notation for 1,5-dimethylindole-2-carboxylic acid?
The canonical SMILES for 1,5-dimethylindole-2-carboxylic acid is Cc1ccc2c(c1)cc(C(=O)O)n2C.
What is the InChIKey of 1,5-dimethylindole-2-carboxylic acid?
The InChIKey is WBVJWABYADZXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-7-3-4-9-8(5-7)6-10(11(13)14)12(9)2/h3-6H,1-2H3,(H,13,14).
What are the key properties of 1,5-dimethylindole-2-carboxylic acid?
1,5-dimethylindole-2-carboxylic acid has a molecular weight of 189.21 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylindole-2-carboxylic acid is sourced from PubChem (CID 937169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).