C20H25N3O3 — CID 9371918
2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]-N-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 9371918) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]-N-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]-N-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 9371918 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]-N-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)/C(=N/NC(=O)C[C@H]1Oc3ccccc3NC1=O)C2 |
| InChI | InChI=1S/C20H25N3O3/c1-19(2)12-8-9-20(19,3)16(10-12)22-23-17(24)11-15-18(25)21-13-6-4-5-7-14(13)26-15/h4-7,12,15H,8-11H2,1-3H3,(H,21,25)(H,23,24)/b22-16+/t12-,15+,20+/m0/s1 |
| InChIKey | WFYQYORCVCATFF-OSHOAJSKSA-N |
| XLogP | 3.09 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|