C21H26N4O — CID 9371945
4-(5-methylpyrazol-1-yl)-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide (PubChem CID 9371945) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-(5-methylpyrazol-1-yl)-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide.
| Compound Name | 4-(5-methylpyrazol-1-yl)-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
|---|---|
| PubChem CID | 9371945 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-(5-methylpyrazol-1-yl)-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
| SMILES | Cc1ccnn1-c1ccc(C(=O)N/N=C2/C[C@H]3CC[C@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-14-10-12-22-25(14)17-7-5-15(6-8-17)19(26)24-23-18-13-16-9-11-21(18,4)20(16,2)3/h5-8,10,12,16H,9,11,13H2,1-4H3,(H,24,26)/b23-18-/t16-,21+/m1/s1 |
| InChIKey | WJJCECQMFJUSFU-OKVKKWKKSA-N |
| XLogP | 4.11 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|