About N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide
N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide (PubChem CID 9373062) has the molecular formula C7H11N3O2S2
and a molecular weight of 233.32 g/mol. Its IUPAC name is N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide |
| PubChem CID | 9373062 |
| Molecular Formula | C7H11N3O2S2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSC1=NCCS1 |
| InChI | InChI=1S/C7H11N3O2S2/c1-5(11)9-10-6(12)4-14-7-8-2-3-13-7/h2-4H2,1H3,(H,9,11)(H,10,12) |
| InChIKey | HCFQTGFKWYWUSB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide?
The IUPAC name of N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide (CID 9373062) is N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide.
What is the SMILES notation for N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide?
The canonical SMILES for N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide is CC(=O)NNC(=O)CSC1=NCCS1.
What is the InChIKey of N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide?
The InChIKey is HCFQTGFKWYWUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S2/c1-5(11)9-10-6(12)4-14-7-8-2-3-13-7/h2-4H2,1H3,(H,9,11)(H,10,12).
What are the key properties of N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide?
N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide has a molecular weight of 233.32 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetohydrazide is sourced from PubChem (CID 9373062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).