About (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide
(2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide (PubChem CID 9373103) has the molecular formula C9H17NO4S2
and a molecular weight of 267.37 g/mol. Its IUPAC name is (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide.
Molecular Properties
| Compound Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide |
| PubChem CID | 9373103 |
| Molecular Formula | C9H17NO4S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide |
| SMILES | C[C@H](SCCO)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO4S2/c1-7(15-4-3-11)9(12)10-8-2-5-16(13,14)6-8/h7-8,11H,2-6H2,1H3,(H,10,12)/t7-,8-/m0/s1 |
| InChIKey | FCBBQWKJDNLTGY-YUMQZZPRSA-N |
| XLogP | -0.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide?
The IUPAC name of (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide (CID 9373103) is (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide.
What is the SMILES notation for (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide?
The canonical SMILES for (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide is C[C@H](SCCO)C(=O)N[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide?
The InChIKey is FCBBQWKJDNLTGY-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H17NO4S2/c1-7(15-4-3-11)9(12)10-8-2-5-16(13,14)6-8/h7-8,11H,2-6H2,1H3,(H,10,12)/t7-,8-/m0/s1.
What are the key properties of (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide?
(2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide has a molecular weight of 267.37 g/mol, XLogP of -0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-hydroxyethylsulfanyl)propanamide is sourced from PubChem (CID 9373103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).