C17H15N3O2 — CID 937357
5,13,15-trimethyl-10,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11-hexaene-14,16-dione (PubChem CID 937357) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 5,13,15-trimethyl-10,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11-hexaene-14,16-dione.
| Compound Name | 5,13,15-trimethyl-10,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11-hexaene-14,16-dione |
|---|---|
| PubChem CID | 937357 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5,13,15-trimethyl-10,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11-hexaene-14,16-dione |
| SMILES | Cc1ccc2c(ccn3cc4c(c(=O)n(C)c(=O)n4C)c23)c1 |
| InChI | InChI=1S/C17H15N3O2/c1-10-4-5-12-11(8-10)6-7-20-9-13-14(15(12)20)16(21)19(3)17(22)18(13)2/h4-9H,1-3H3 |
| InChIKey | XEGSMMVSGHNCAT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 48.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |