About (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide
(2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide (PubChem CID 9373940) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide.
Molecular Properties
| Compound Name | (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide |
| PubChem CID | 9373940 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide |
| SMILES | Cc1nnc(S[C@@H](C)C(=O)NCC(C)C)o1 |
| InChI | InChI=1S/C10H17N3O2S/c1-6(2)5-11-9(14)7(3)16-10-13-12-8(4)15-10/h6-7H,5H2,1-4H3,(H,11,14)/t7-/m0/s1 |
| InChIKey | HZOIIEZZHJIVNN-ZETCQYMHSA-N |
| XLogP | 1.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide?
The IUPAC name of (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide (CID 9373940) is (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide.
What is the SMILES notation for (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide?
The canonical SMILES for (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide is Cc1nnc(S[C@@H](C)C(=O)NCC(C)C)o1.
What is the InChIKey of (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide?
The InChIKey is HZOIIEZZHJIVNN-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-6(2)5-11-9(14)7(3)16-10-13-12-8(4)15-10/h6-7H,5H2,1-4H3,(H,11,14)/t7-/m0/s1.
What are the key properties of (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide?
(2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide has a molecular weight of 243.33 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-methylpropyl)propanamide is sourced from PubChem (CID 9373940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).