C16H20N2O3S2 — CID 9373999
[2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 9373999) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 9373999 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H20N2O3S2/c19-15(11-23-16(22)18-7-3-4-8-18)17-9-12-10-20-13-5-1-2-6-14(13)21-12/h1-2,5-6,12H,3-4,7-11H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | KOYITTCAUJOZRT-LBPRGKRZSA-N |
| XLogP | 2.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|