About 2-pyrrolidin-1-ylaniline
2-pyrrolidin-1-ylaniline (PubChem CID 937501) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylaniline.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylaniline |
| PubChem CID | 937501 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-pyrrolidin-1-ylaniline |
| SMILES | Nc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C10H14N2/c11-9-5-1-2-6-10(9)12-7-3-4-8-12/h1-2,5-6H,3-4,7-8,11H2 |
| InChIKey | BFPUBGCFJMIZDF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylaniline?
The IUPAC name of 2-pyrrolidin-1-ylaniline (CID 937501) is 2-pyrrolidin-1-ylaniline.
What is the SMILES notation for 2-pyrrolidin-1-ylaniline?
The canonical SMILES for 2-pyrrolidin-1-ylaniline is Nc1ccccc1N1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylaniline?
The InChIKey is BFPUBGCFJMIZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c11-9-5-1-2-6-10(9)12-7-3-4-8-12/h1-2,5-6H,3-4,7-8,11H2.
What are the key properties of 2-pyrrolidin-1-ylaniline?
2-pyrrolidin-1-ylaniline has a molecular weight of 162.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylaniline is sourced from PubChem (CID 937501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).