C10H17N5O4S — CID 9375858
2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)acetamide (PubChem CID 9375858) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9375858 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CSc1n[nH]c(=O)n1CCCOC |
| InChI | InChI=1S/C10H17N5O4S/c1-11-8(17)12-7(16)6-20-10-14-13-9(18)15(10)4-3-5-19-2/h3-6H2,1-2H3,(H,13,18)(H2,11,12,16,17) |
| InChIKey | NTTKRPXQKJMXIC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|