C16H15F2N3O3 — CID 9376830
2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-(3-nitrophenyl)acetamide (PubChem CID 9376830) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9376830 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-(3-nitrophenyl)acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1cccc([N+](=O)[O-])c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15F2N3O3/c1-10(11-5-6-14(17)15(18)7-11)19-9-16(22)20-12-3-2-4-13(8-12)21(23)24/h2-8,10,19H,9H2,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | YANIQZOAQGCKDS-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|