C11H17N5O2S — CID 9378122
N'-acetyl-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide (PubChem CID 9378122) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is N'-acetyl-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 9378122 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N'-acetyl-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(C)=O)nnc1C1CC1 |
| InChI | InChI=1S/C11H17N5O2S/c1-3-16-10(8-4-5-8)14-15-11(16)19-6-9(18)13-12-7(2)17/h8H,3-6H2,1-2H3,(H,12,17)(H,13,18) |
| InChIKey | MLIIWJGSDAYSRU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|