C25H23NO4 — CID 9378196
methyl 4-methyl-3-[[4-oxo-4-(4-phenylphenyl)butanoyl]amino]benzoate (PubChem CID 9378196) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is methyl 4-methyl-3-[[4-oxo-4-(4-phenylphenyl)butanoyl]amino]benzoate.
| Compound Name | methyl 4-methyl-3-[[4-oxo-4-(4-phenylphenyl)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 9378196 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | methyl 4-methyl-3-[[4-oxo-4-(4-phenylphenyl)butanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CCC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H23NO4/c1-17-8-9-21(25(29)30-2)16-22(17)26-24(28)15-14-23(27)20-12-10-19(11-13-20)18-6-4-3-5-7-18/h3-13,16H,14-15H2,1-2H3,(H,26,28) |
| InChIKey | HOVWNOIGNNSFPV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |