C23H18N2O3 — CID 9378346
N-(9H-fluoren-3-yl)-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide (PubChem CID 9378346) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(9H-fluoren-3-yl)-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide.
| Compound Name | N-(9H-fluoren-3-yl)-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
|---|---|
| PubChem CID | 9378346 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(9H-fluoren-3-yl)-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1Oc2ccccc2NC1=O)Nc1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C23H18N2O3/c26-22(13-21-23(27)25-19-7-3-4-8-20(19)28-21)24-16-10-9-15-11-14-5-1-2-6-17(14)18(15)12-16/h1-10,12,21H,11,13H2,(H,24,26)(H,25,27)/t21-/m0/s1 |
| InChIKey | PRKVUOIQRZYWBD-NRFANRHFSA-N |
| XLogP | 3.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |