About 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile
2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile (PubChem CID 9378682) has the molecular formula C7H10N4S2
and a molecular weight of 214.32 g/mol. Its IUPAC name is 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile |
| PubChem CID | 9378682 |
| Molecular Formula | C7H10N4S2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile |
| SMILES | CCCNc1nnc(SCC#N)s1 |
| InChI | InChI=1S/C7H10N4S2/c1-2-4-9-6-10-11-7(13-6)12-5-3-8/h2,4-5H2,1H3,(H,9,10) |
| InChIKey | FYZDKSWFQVIMHI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile?
The IUPAC name of 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile (CID 9378682) is 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile.
What is the SMILES notation for 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile?
The canonical SMILES for 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile is CCCNc1nnc(SCC#N)s1.
What is the InChIKey of 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile?
The InChIKey is FYZDKSWFQVIMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4S2/c1-2-4-9-6-10-11-7(13-6)12-5-3-8/h2,4-5H2,1H3,(H,9,10).
What are the key properties of 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile?
2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile has a molecular weight of 214.32 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetonitrile is sourced from PubChem (CID 9378682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).