C12H16N2O5 — CID 9378975
methyl N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]carbamate (PubChem CID 9378975) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is methyl N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]carbamate.
| Compound Name | methyl N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]carbamate |
|---|---|
| PubChem CID | 9378975 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C12H16N2O5/c1-19-11(18)13-8(15)7-14-9(16)6-12(10(14)17)4-2-3-5-12/h2-7H2,1H3,(H,13,15,18) |
| InChIKey | QTFXKBLZRNURPX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|