C14H21N3O4 — CID 9378986
2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide (PubChem CID 9378986) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 9378986 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide |
| SMILES | CNC(=O)CN(C)C(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C14H21N3O4/c1-15-10(18)8-16(2)12(20)9-17-11(19)7-14(13(17)21)5-3-4-6-14/h3-9H2,1-2H3,(H,15,18) |
| InChIKey | IBKRGMIWUPGGRN-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|