C15H23N3O4 — CID 9378993
2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]-N-propylacetamide (PubChem CID 9378993) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]-N-propylacetamide.
| Compound Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 9378993 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C15H23N3O4/c1-2-7-16-11(19)9-17-12(20)10-18-13(21)8-15(14(18)22)5-3-4-6-15/h2-10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | POEKOHHZIWUHNU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|