About propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate
propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 937934) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| PubChem CID | 937934 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CC(C)OC(=O)CSc1nnc(-c2ccccc2)n1N |
| InChI | InChI=1S/C13H16N4O2S/c1-9(2)19-11(18)8-20-13-16-15-12(17(13)14)10-6-4-3-5-7-10/h3-7,9H,8,14H2,1-2H3 |
| InChIKey | IURGJNGIYBNZMN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The IUPAC name of propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate (CID 937934) is propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
What is the SMILES notation for propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The canonical SMILES for propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate is CC(C)OC(=O)CSc1nnc(-c2ccccc2)n1N.
What is the InChIKey of propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The InChIKey is IURGJNGIYBNZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-9(2)19-11(18)8-20-13-16-15-12(17(13)14)10-6-4-3-5-7-10/h3-7,9H,8,14H2,1-2H3.
What are the key properties of propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate has a molecular weight of 292.36 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate is sourced from PubChem (CID 937934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).