C12H17N3O6S — CID 9379879
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide (PubChem CID 9379879) has the molecular formula C12H17N3O6S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 9379879 |
| Molecular Formula | C12H17N3O6S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
| SMILES | CCCN1C(=O)C(=O)N(CC(=O)N[C@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C12H17N3O6S/c1-2-4-14-10(17)11(18)15(12(14)19)6-9(16)13-8-3-5-22(20,21)7-8/h8H,2-7H2,1H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | PSOMUCUQCPNGNH-QMMMGPOBSA-N |
| XLogP | -1.51 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|