About (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate
(6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 9380722) has the molecular formula C20H18N4O3
and a molecular weight of 362.39 g/mol. Its IUPAC name is (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
| PubChem CID | 9380722 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCc1cn2cc(C)ccc2n1 |
| InChI | InChI=1S/C20H18N4O3/c1-14-8-9-18-21-15(11-23(18)10-14)13-27-20(25)19-17(26-2)12-24(22-19)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3 |
| InChIKey | KKTZJMAJWNNOSW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate?
The IUPAC name of (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate (CID 9380722) is (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate.
What is the SMILES notation for (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate?
The canonical SMILES for (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate is COc1cn(-c2ccccc2)nc1C(=O)OCc1cn2cc(C)ccc2n1.
What is the InChIKey of (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate?
The InChIKey is KKTZJMAJWNNOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3/c1-14-8-9-18-21-15(11-23(18)10-14)13-27-20(25)19-17(26-2)12-24(22-19)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3.
What are the key properties of (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate?
(6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate has a molecular weight of 362.39 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-methoxy-1-phenylpyrazole-3-carboxylate is sourced from PubChem (CID 9380722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).