C15H16N4O4 — CID 938100
8-(2,4-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 938100) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 8-(2,4-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(2,4-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 938100 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 8-(2,4-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)c(OC)c1 |
| InChI | InChI=1S/C15H16N4O4/c1-18-13-11(14(20)19(2)15(18)21)16-12(17-13)9-6-5-8(22-3)7-10(9)23-4/h5-7H,1-4H3,(H,16,17) |
| InChIKey | HBUQFUGZVUPQIO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |