C20H20FNO4 — CID 9381401
[2-[4-[(1R)-1-acetamidoethyl]phenyl]-2-oxoethyl] 3-fluoro-4-methylbenzoate (PubChem CID 9381401) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is [2-[4-[(1R)-1-acetamidoethyl]phenyl]-2-oxoethyl] 3-fluoro-4-methylbenzoate.
| Compound Name | [2-[4-[(1R)-1-acetamidoethyl]phenyl]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9381401 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [2-[4-[(1R)-1-acetamidoethyl]phenyl]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
| SMILES | CC(=O)N[C@H](C)c1ccc(C(=O)COC(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-12-4-5-17(10-18(12)21)20(25)26-11-19(24)16-8-6-15(7-9-16)13(2)22-14(3)23/h4-10,13H,11H2,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | GFYBJPUFKGBKFA-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |