About (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol
(1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol (PubChem CID 938158) has the molecular formula C7H12ClN2O+
and a molecular weight of 175.64 g/mol. Its IUPAC name is (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol |
| PubChem CID | 938158 |
| Molecular Formula | C7H12ClN2O+ |
| Molecular Weight | 175.64 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol |
| SMILES | C[C@H](O)c1n(C)c(Cl)c[n+]1C |
| InChI | InChI=1S/C7H12ClN2O/c1-5(11)7-9(2)4-6(8)10(7)3/h4-5,11H,1-3H3/q+1/t5-/m0/s1 |
| InChIKey | OZAADURTHVCJNH-YFKPBYRVSA-N |
| XLogP | 0.56 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.64 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol?
The IUPAC name of (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol (CID 938158) is (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol.
What is the SMILES notation for (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol?
The canonical SMILES for (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol is C[C@H](O)c1n(C)c(Cl)c[n+]1C.
What is the InChIKey of (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol?
The InChIKey is OZAADURTHVCJNH-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H12ClN2O/c1-5(11)7-9(2)4-6(8)10(7)3/h4-5,11H,1-3H3/q+1/t5-/m0/s1.
What are the key properties of (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol?
(1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol has a molecular weight of 175.64 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol is sourced from PubChem (CID 938158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).