C21H22F3NO4 — CID 9382770
[(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-(propan-2-yloxymethyl)benzoate (PubChem CID 9382770) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-(propan-2-yloxymethyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-(propan-2-yloxymethyl)benzoate |
|---|---|
| PubChem CID | 9382770 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [(2S)-1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 4-(propan-2-yloxymethyl)benzoate |
| SMILES | CC(C)OCc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO4/c1-13(2)28-12-15-8-10-16(11-9-15)20(27)29-14(3)19(26)25-18-7-5-4-6-17(18)21(22,23)24/h4-11,13-14H,12H2,1-3H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | SZMSMELARVFBLR-AWEZNQCLSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |