C14H11BrFNO3S — CID 9383451
[(2R)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] thiophene-3-carboxylate (PubChem CID 9383451) has the molecular formula C14H11BrFNO3S and a molecular weight of 372.22 g/mol. Its IUPAC name is [(2R)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] thiophene-3-carboxylate.
| Compound Name | [(2R)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] thiophene-3-carboxylate |
|---|---|
| PubChem CID | 9383451 |
| Molecular Formula | C14H11BrFNO3S |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | [(2R)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] thiophene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccsc1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H11BrFNO3S/c1-8(20-14(19)9-4-5-21-7-9)13(18)17-12-3-2-10(15)6-11(12)16/h2-8H,1H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | FSYPWOORLCBAPN-MRVPVSSYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |