C17H19FN2O4S — CID 9383871
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 9383871) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9383871 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1sc(-c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C17H19FN2O4S/c1-10-14(17(22)24-11(2)15(21)19-8-9-23-3)25-16(20-10)12-4-6-13(18)7-5-12/h4-7,11H,8-9H2,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | SPQZPAMSPAVOLR-LLVKDONJSA-N |
| XLogP | 2.57 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|