C16H23N5O4S — CID 9384065
(2S)-2-[[4-amino-5-(2,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide (PubChem CID 9384065) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is (2S)-2-[[4-amino-5-(2,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[[4-amino-5-(2,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 9384065 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (2S)-2-[[4-amino-5-(2,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nnc(-c2ccc(OC)cc2OC)n1N |
| InChI | InChI=1S/C16H23N5O4S/c1-10(15(22)18-7-8-23-2)26-16-20-19-14(21(16)17)12-6-5-11(24-3)9-13(12)25-4/h5-6,9-10H,7-8,17H2,1-4H3,(H,18,22)/t10-/m0/s1 |
| InChIKey | ONJDVKDNQQDPNM-JTQLQIEISA-N |
| XLogP | 0.92 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|