C23H19F2NO4 — CID 9384914
[(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 9384914) has the molecular formula C23H19F2NO4 and a molecular weight of 411.40 g/mol. Its IUPAC name is [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9384914 |
| Molecular Formula | C23H19F2NO4 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COc1ccc2cc(/C=C/C(=O)O[C@H](C)C(=O)Nc3cc(F)ccc3F)ccc2c1 |
| InChI | InChI=1S/C23H19F2NO4/c1-14(23(28)26-21-13-18(24)7-9-20(21)25)30-22(27)10-4-15-3-5-17-12-19(29-2)8-6-16(17)11-15/h3-14H,1-2H3,(H,26,28)/b10-4+/t14-/m1/s1 |
| InChIKey | FGANYQZECVRLHJ-LZTOIUFZSA-N |
| XLogP | 4.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|