C16H15NO5 — CID 9385740
[2-(4-methoxyphenyl)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385740) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385740 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(C(C)=O)c[nH]2)cc1 |
| InChI | InChI=1S/C16H15NO5/c1-10(18)12-7-14(17-8-12)16(20)22-9-15(19)11-3-5-13(21-2)6-4-11/h3-8,17H,9H2,1-2H3 |
| InChIKey | OILYNMDUZYLTNJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |