About ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate
ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate (PubChem CID 9387694) has the molecular formula C13H22N4O4S
and a molecular weight of 330.41 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate |
| PubChem CID | 9387694 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1nnc(S[C@@H](C)C(=O)NCCOC)n1C |
| InChI | InChI=1S/C13H22N4O4S/c1-5-21-11(18)8-10-15-16-13(17(10)3)22-9(2)12(19)14-6-7-20-4/h9H,5-8H2,1-4H3,(H,14,19)/t9-/m0/s1 |
| InChIKey | HLQTVFSYRVFHLC-VIFPVBQESA-N |
| XLogP | 0.16 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate?
The IUPAC name of ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate (CID 9387694) is ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate.
What is the SMILES notation for ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate?
The canonical SMILES for ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate is CCOC(=O)Cc1nnc(S[C@@H](C)C(=O)NCCOC)n1C.
What is the InChIKey of ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate?
The InChIKey is HLQTVFSYRVFHLC-VIFPVBQESA-N. The full InChI is InChI=1S/C13H22N4O4S/c1-5-21-11(18)8-10-15-16-13(17(10)3)22-9(2)12(19)14-6-7-20-4/h9H,5-8H2,1-4H3,(H,14,19)/t9-/m0/s1.
What are the key properties of ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate?
ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate has a molecular weight of 330.41 g/mol, XLogP of 0.16, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetate is sourced from PubChem (CID 9387694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).