C11H16N6S — CID 938883
2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-methyl-4,5-dihydroimidazole-1-carbothioamide (PubChem CID 938883) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-methyl-4,5-dihydroimidazole-1-carbothioamide.
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-methyl-4,5-dihydroimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 938883 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-methyl-4,5-dihydroimidazole-1-carbothioamide |
| SMILES | CNC(=S)N1CCN=C1Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C11H16N6S/c1-7-6-8(2)15-9(14-7)16-10-13-4-5-17(10)11(18)12-3/h6H,4-5H2,1-3H3,(H,12,18)(H,13,14,15,16) |
| InChIKey | ZCKAGTIIQVEIGE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|