C9H14N2O4S2 — CID 9389121
3-[[5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-ol (PubChem CID 9389121) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-[[5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 9389121 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-[[5-[(3R)-1,1-dioxothiolan-3-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-ol |
| SMILES | O=S1(=O)CC[C@H](c2nnc(SCCCO)o2)C1 |
| InChI | InChI=1S/C9H14N2O4S2/c12-3-1-4-16-9-11-10-8(15-9)7-2-5-17(13,14)6-7/h7,12H,1-6H2/t7-/m0/s1 |
| InChIKey | YFZHQVJBVSPOJB-ZETCQYMHSA-N |
| XLogP | 0.45 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|