C22H19N3OS2 — CID 9389594
N-[(1S)-1,2-diphenylethyl]-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide (PubChem CID 9389594) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 9389594 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncnc2sccc12)N[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3OS2/c26-20(14-28-22-18-11-12-27-21(18)23-15-24-22)25-19(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-12,15,19H,13-14H2,(H,25,26)/t19-/m0/s1 |
| InChIKey | OWHTYFAWWRPUGK-IBGZPJMESA-N |
| XLogP | 4.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |