C12H20N4O4S2 — CID 9389633
2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 9389633) has the molecular formula C12H20N4O4S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 9389633 |
| Molecular Formula | C12H20N4O4S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nnc([C@@H]2CCS(=O)(=O)C2)n1C |
| InChI | InChI=1S/C12H20N4O4S2/c1-16-11(9-3-6-22(18,19)8-9)14-15-12(16)21-7-10(17)13-4-5-20-2/h9H,3-8H2,1-2H3,(H,13,17)/t9-/m1/s1 |
| InChIKey | XBNOUESOPYUTGX-SECBINFHSA-N |
| XLogP | -0.43 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|